EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | [H][C@]12C[C@@H](O)C(CO)=CC(=O)[C@]1(C)CC[C@@]1(C)CCC(C(C)C)=C12 |
| InChI | InChI=1S/C20H30O3/c1-12(2)14-5-6-19(3)7-8-20(4)15(18(14)19)10-16(22)13(11-21)9-17(20)23/h9,12,15-16,21-22H,5-8,10-11H2,1-4H3/t15-,16-,19-,20-/m1/s1 |
| InChIKey | RGROGZCBGZBCAG-XNFNUYLZSA-N |
| Roles Classification |
|---|
| Biological Role: | nerve growth factor stimulator Any molecule shown to have the potentiality in stimulating the effect of nerve growth factor. |
| Application: | nerve growth factor stimulator Any molecule shown to have the potentiality in stimulating the effect of nerve growth factor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyathin A3 (CHEBI:3985) has role nerve growth factor stimulator (CHEBI:72294) |
| cyathin A3 (CHEBI:3985) is a tricyclic diterpenoid (CHEBI:79084) |
| Synonym | Source |
|---|---|
| cyathin A3 | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| cyathin A3 | UniProt |
| Citations |
|---|