EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H31O16 |
| Net Charge | +1 |
| Average Mass | 611.529 |
| Monoisotopic Mass | 611.16066 |
| SMILES | OC[C@H]1O[C@@H](Oc2cc3c(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H30O16/c28-7-17-19(33)21(35)23(37)26(42-17)40-15-5-10(30)4-14-11(15)6-16(25(39-14)9-1-2-12(31)13(32)3-9)41-27-24(38)22(36)20(34)18(8-29)43-27/h1-6,17-24,26-29,33-38H,7-8H2,(H2-,30,31,32)/p+1/t17-,18-,19-,20-,21+,22+,23-,24-,26-,27-/m1/s1 |
| InChIKey | RDFLLVCQYHQOBU-ZOTFFYTFSA-O |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyanin (CHEBI:3978) has functional parent cyanidin cation (CHEBI:27843) |
| cyanin (CHEBI:3978) has role plant metabolite (CHEBI:76924) |
| cyanin (CHEBI:3978) is a anthocyanin cation (CHEBI:35218) |
| cyanin (CHEBI:3978) is a β-D-glucoside (CHEBI:22798) |
| cyanin (CHEBI:3978) is conjugate acid of cyanin betaine (CHEBI:71511) |
| Incoming Relation(s) |
| cyanin chloride (CHEBI:38021) has part cyanin (CHEBI:3978) |
| cyanin betaine (CHEBI:71511) is conjugate base of cyanin (CHEBI:3978) |
| IUPAC Name |
|---|
| 3,5-bis(β-D-glucopyranosyloxy)-3',4',7-trihydroxyflavylium |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)-3-(β-D-glucopyranosyloxy)-7-hydroxychromenylium-5-yl β-D-glucopyranoside | IUPAC |
| Cyanidin 3,5-diglucoside | LIPID MAPS |
| Cyanidin 3,5-di-O-glucoside | KEGG COMPOUND |
| Cyanidin 3,5-O-diglucoside | KEGG COMPOUND |
| Cyanin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00002378 | KNApSAcK |
| C08639 | KEGG COMPOUND |
| CPD-7138 | MetaCyc |
| LMPK12010113 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1417221 | Reaxys |
| CAS:20905-74-2 | KEGG COMPOUND |
| Citations |
|---|