EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO |
| Net Charge | 0 |
| Average Mass | 123.155 |
| Monoisotopic Mass | 123.06841 |
| SMILES | Cc1ccc(O)c(N)c1 |
| InChI | InChI=1S/C7H9NO/c1-5-2-3-7(9)6(8)4-5/h2-4,9H,8H2,1H3 |
| InChIKey | ZMXYNJXDULEQCK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. sensitiser A chemical compound that causes a substantial proportion of exposed people or animals to develop an allergic reaction in normal tissue after repeated exposure to the compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-4-methylphenol (CHEBI:39713) has role sensitiser (CHEBI:139492) |
| 2-amino-4-methylphenol (CHEBI:39713) has role xenobiotic metabolite (CHEBI:76206) |
| 2-amino-4-methylphenol (CHEBI:39713) is a hydroxytoluene (CHEBI:24751) |
| 2-amino-4-methylphenol (CHEBI:39713) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| 2-amino-4-methylphenol |
| Synonyms | Source |
|---|---|
| 2-amino-p-cresol | PDBeChem |
| 2-hydroxy-5-methylaniline | ChEBI |
| 3-amino-4-hydroxytoluene | ChEBI |
| 6-hydroxy-m-toluidine | ChEBI |
| 1-amino-2-hydroxy-5-methylbenzene | ChEBI |
| 1-hydroxy-2-amino-4-methylbenzene | ChEBI |
| Citations |
|---|