EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H13NO3S |
| Net Charge | 0 |
| Average Mass | 299.351 |
| Monoisotopic Mass | 299.06161 |
| SMILES | O=S(=O)(O)c1cccc2cccc(Nc3ccccc3)c12 |
| InChI | InChI=1S/C16H13NO3S/c18-21(19,20)15-11-5-7-12-6-4-10-14(16(12)15)17-13-8-2-1-3-9-13/h1-11,17H,(H,18,19,20) |
| InChIKey | FWEOQOXTVHGIFQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-anilinonaphthalene-1-sulfonic acid (CHEBI:39708) has role fluorescent probe (CHEBI:39442) |
| 8-anilinonaphthalene-1-sulfonic acid (CHEBI:39708) is a aminonaphthalene (CHEBI:38034) |
| 8-anilinonaphthalene-1-sulfonic acid (CHEBI:39708) is a naphthalenesulfonic acid (CHEBI:36336) |
| IUPAC Name |
|---|
| 8-anilinonaphthalene-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| 1-Anilino-8-naphthalenesulfonate | KEGG COMPOUND |
| 1-ANILINO-8-NAPHTHALENE SULFONATE | PDBeChem |
| 1-anilino-8-naphthalenesulfonic acid | ChemIDplus |
| 1-(phenylamino)-8-naphthalenesulfonic acid | ChemIDplus |
| 8-Anilino-1-naphthalene sulfonic acid | KEGG COMPOUND |
| 8-anilinonaphthalene-1-sulphonic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 2AN | PDBeChem |
| 8-Anilinonaphthalene-1-sulfonic_acid | Wikipedia |
| C11326 | KEGG COMPOUND |
| DB04474 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1843887 | Beilstein |
| Reaxys:1843887 | Reaxys |
| CAS:82-76-8 | KEGG COMPOUND |
| CAS:82-76-8 | ChemIDplus |
| Citations |
|---|