EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO4 |
| Net Charge | 0 |
| Average Mass | 223.228 |
| Monoisotopic Mass | 223.08446 |
| SMILES | N[C@@H](Cc1ccc(CC(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C11H13NO4/c12-9(11(15)16)5-7-1-3-8(4-2-7)6-10(13)14/h1-4,9H,5-6,12H2,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | LJHYWUVYIKCPGU-VIFPVBQESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(carboxymethyl)-L-phenylalanine (CHEBI:39685) is a L-phenylalanine derivative (CHEBI:84144) |
| 4-(carboxymethyl)-L-phenylalanine (CHEBI:39685) is a 4-(carboxymethyl)phenylalanine (CHEBI:228213) |
| 4-(carboxymethyl)-L-phenylalanine (CHEBI:39685) is enantiomer of 4-(carboxymethyl)-D-phenylalanine (CHEBI:228221) |
| Incoming Relation(s) |
| 4-(carboxymethyl)-D-phenylalanine (CHEBI:228221) is enantiomer of 4-(carboxymethyl)-L-phenylalanine (CHEBI:39685) |
| IUPAC Name |
|---|
| 4-(carboxymethyl)-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-3-[4-(carboxymethyl)phenyl]propanoic acid | IUPAC |
| 4-carboxymethyl-L-phenylalanine | ChEBI |
| p-carboxymethyl-L-phenylalanine | ChEBI |
| pCMF | ChEBI |
| (2S)-2-azanyl-3-[4-(carboxymethyl)phenyl]propanoic acid | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| 1PA | PDBeChem |
| Citations |
|---|