EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N5O6S |
| Net Charge | 0 |
| Average Mass | 381.370 |
| Monoisotopic Mass | 381.07430 |
| SMILES | COC(=O)c1ccccc1S(=O)(=O)NC(=O)Nc1nc(C)nc(OC)n1 |
| InChI | InChI=1S/C14H15N5O6S/c1-8-15-12(18-14(16-8)25-3)17-13(21)19-26(22,23)10-7-5-4-6-9(10)11(20)24-2/h4-7H,1-3H3,(H2,15,16,17,18,19,21) |
| InChIKey | RSMUVYRMZCOLBH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metsulfuron methyl (CHEBI:39678) has role environmental contaminant (CHEBI:78298) |
| metsulfuron methyl (CHEBI:39678) has role herbicide (CHEBI:24527) |
| metsulfuron methyl (CHEBI:39678) has role xenobiotic (CHEBI:35703) |
| metsulfuron methyl (CHEBI:39678) is a N-sulfonylurea (CHEBI:76983) |
| metsulfuron methyl (CHEBI:39678) is a benzoate ester (CHEBI:36054) |
| metsulfuron methyl (CHEBI:39678) is a methoxy-1,3,5-triazine (CHEBI:38177) |
| IUPAC Name |
|---|
| methyl 2-{[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]sulfamoyl}benzoate |
| Synonyms | Source |
|---|---|
| metsulfuron-methyl | ChEBI |
| Metsulfuron methyl | KEGG COMPOUND |
| Metsulfuron methyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1MM | PDBeChem |
| 470 | PPDB |
| C10946 | KEGG COMPOUND |
| metsulfuron-methyl | Alan Wood's Pesticides |
| Metsulfuron-methyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:587472 | Reaxys |
| CAS:74223-64-6 | KEGG COMPOUND |
| CAS:74223-64-6 | ChemIDplus |
| Citations |
|---|