EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18O10 |
| Net Charge | 0 |
| Average Mass | 538.464 |
| Monoisotopic Mass | 538.09000 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc34)c(O)cc(O)c12 |
| InChI | InChI=1S/C30H18O10/c31-15-5-1-13(2-6-15)23-11-21(37)25-17(33)9-19(35)27(29(25)39-23)28-20(36)10-18(34)26-22(38)12-24(40-30(26)28)14-3-7-16(32)8-4-14/h1-12,31-36H |
| InChIKey | LADPNODMUXOPRG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupressus cashmeriana (ncbitaxon:187464) | leaf (BTO:0000713) | DOI (10.1021/np50051a032) | |
| Cupressus sempervirens (ncbitaxon:13469) | leaf (BTO:0000713) | DOI (10.1021/np50051a032) | |
| Glossostemon bruguieri (ncbitaxon:133565) | root (BTO:0001188) | DOI (10.3390/80800614) | |
| Juniperus occidentalis (ncbitaxon:114265) | root (BTO:0001188) | PubMed (12372862) | |
| Microbiota decussata (ncbitaxon:13614) | leaf (BTO:0000713) | PubMed (12562084) | |
| Thuja orientalis (ncbitaxon:58046) | fruit (BTO:0000486) | PubMed (19280159) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | EC 3.4.21.37 (leukocyte elastase) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the activity of leukocyte elastase (EC 3.4.21.37). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cupressuflavone (CHEBI:3960) has role EC 3.4.21.37 (leukocyte elastase) inhibitor (CHEBI:64922) |
| cupressuflavone (CHEBI:3960) has role metabolite (CHEBI:25212) |
| cupressuflavone (CHEBI:3960) has role radical scavenger (CHEBI:48578) |
| cupressuflavone (CHEBI:3960) is a biflavonoid (CHEBI:50128) |
| cupressuflavone (CHEBI:3960) is a hydroxyflavone (CHEBI:24698) |
| cupressuflavone (CHEBI:3960) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-4H,4'H-8,8'-bichromene-4,4'-dione |
| Synonyms | Source |
|---|---|
| 4',4''',5,5'',7,7''-hexahydroxy-8-8''-biflavone | ChEBI |
| 8,8''-Biapigenin | KEGG COMPOUND |
| Cupressuflavone | KEGG COMPOUND |
| Citations |
|---|