EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18O10 |
| Net Charge | 0 |
| Average Mass | 538.464 |
| Monoisotopic Mass | 538.09000 |
| SMILES | O=c1cc(-c2ccc(O)cc2)oc2c(-c3c(O)cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc34)c(O)cc(O)c12 |
| InChI | InChI=1S/C30H18O10/c31-15-5-1-13(2-6-15)23-11-21(37)25-17(33)9-19(35)27(29(25)39-23)28-20(36)10-18(34)26-22(38)12-24(40-30(26)28)14-3-7-16(32)8-4-14/h1-12,31-36H |
| InChIKey | LADPNODMUXOPRG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cupressus cashmeriana (ncbitaxon:187464) | leaf (BTO:0000713) | DOI (10.1021/np50051a032) | |
| Cupressus sempervirens (ncbitaxon:13469) | leaf (BTO:0000713) | DOI (10.1021/np50051a032) | |
| Glossostemon bruguieri (ncbitaxon:133565) | root (BTO:0001188) | DOI (10.3390/80800614) | |
| Juniperus occidentalis (ncbitaxon:114265) | root (BTO:0001188) | PubMed (12372862) | |
| Microbiota decussata (ncbitaxon:13614) | leaf (BTO:0000713) | PubMed (12562084) | |
| Thuja orientalis (ncbitaxon:58046) | fruit (BTO:0000486) | PubMed (19280159) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.37 (leukocyte elastase) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the activity of leukocyte elastase (EC 3.4.21.37). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cupressuflavone (CHEBI:3960) has role EC 3.4.21.37 (leukocyte elastase) inhibitor (CHEBI:64922) |
| cupressuflavone (CHEBI:3960) has role metabolite (CHEBI:25212) |
| cupressuflavone (CHEBI:3960) has role radical scavenger (CHEBI:48578) |
| cupressuflavone (CHEBI:3960) is a biflavonoid (CHEBI:50128) |
| cupressuflavone (CHEBI:3960) is a hydroxyflavone (CHEBI:24698) |
| cupressuflavone (CHEBI:3960) is a ring assembly (CHEBI:36820) |
| IUPAC Name |
|---|
| 5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-4H,4'H-8,8'-bichromene-4,4'-dione |
| Synonyms | Source |
|---|---|
| 4',4''',5,5'',7,7''-hexahydroxy-8-8''-biflavone | ChEBI |
| 8,8''-Biapigenin | KEGG COMPOUND |
| Cupressuflavone | KEGG COMPOUND |
| Citations |
|---|