EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39540 - N-hexadecanoylglycine
| Formula | C18H35NO3 |
| Net Charge | 0 |
| Average Mass | 313.482 |
| Monoisotopic Mass | 313.26169 |
| SMILES | CCCCCCCCCCCCCCCC(=O)NCC(=O)O |
| InChI | InChI=1S/C18H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(20)19-16-18(21)22/h2-16H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | KVTFEOAKFFQCCX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calanus helgolandicus (ncbitaxon:114068) | |||
| - | PubMed (26364855) | ||
| - | MetaboLights (MTBLS91) | ||
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23111557) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hexadecanoylglycine (CHEBI:39540) has functional parent hexadecanoic acid (CHEBI:15756) |
| N-hexadecanoylglycine (CHEBI:39540) has role human metabolite (CHEBI:77746) |
| N-hexadecanoylglycine (CHEBI:39540) has role marine metabolite (CHEBI:76507) |
| N-hexadecanoylglycine (CHEBI:39540) is a N-acylglycine 16:0 (CHEBI:134149) |
| N-hexadecanoylglycine (CHEBI:39540) is a fatty amide (CHEBI:29348) |
| N-hexadecanoylglycine (CHEBI:39540) is conjugate acid of N-hexadecanoylglycinate (CHEBI:142655) |
| Incoming Relation(s) |
| N-hexadecanoylglycinate (CHEBI:142655) is conjugate base of N-hexadecanoylglycine (CHEBI:39540) |
| N-hexadecanoylglycyl group (CHEBI:143223) is substituent group from N-hexadecanoylglycine (CHEBI:39540) |
| IUPAC Name |
|---|
| N-hexadecanoylglycine |
| Synonyms | Source |
|---|---|
| N-palmitoylglycine | PDBeChem |
| 2-(Hexadecanoylamino)acetic acid | ChemIDplus |
| 2-hexadecanamidoacetic acid | HMDB |
| Palmitoylglycine | HMDB |
| hexadecanoylglycine | ChEBI |
| elmiric acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| 140 | PDBeChem |
| LMFA08020079 | LIPID MAPS |
| 133100 | ChemSpider |
| HMDB0013034 | HMDB |
| Citations |
|---|