EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O7 |
| Net Charge | 0 |
| Average Mass | 516.675 |
| Monoisotopic Mass | 516.30870 |
| SMILES | [H][C@@]12CC=C3C(C)(C)C(=O)C(O)=C[C@@]3([H])[C@]1(C)C(=O)C[C@@]1(C)[C@@]2(C)C[C@@H](O)[C@]1([H])[C@@](C)(O)C(=O)CCC(C)(C)O |
| InChI | InChI=1S/C30H44O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,13,17,19-20,23,31-32,36-37H,10-12,14-15H2,1-8H3/t17-,19-,20+,23+,27+,28-,29+,30+/m1/s1 |
| InChIKey | PIGAXYFCLPQWOD-ILFSFOJUSA-N |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cucurbitacin L (CHEBI:3949) is a cucurbitacin (CHEBI:16219) |
| Synonym | Source |
|---|---|
| Cucurbitacin L | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C08802 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:1110-02-7 | KEGG COMPOUND |