EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H35N3O6 |
| Net Charge | 0 |
| Average Mass | 449.548 |
| Monoisotopic Mass | 449.25259 |
| SMILES | CC[C@@H](C)[C@@H](NC(=O)[C@@H](CC(=O)NO)Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C23H35N3O6/c1-5-15(4)20(22(29)24-18(23(30)31)11-14(2)3)25-21(28)17(13-19(27)26-32)12-16-9-7-6-8-10-16/h6-10,14-15,17-18,20,32H,5,11-13H2,1-4H3,(H,24,29)(H,25,28)(H,26,27)(H,30,31)/t15-,17-,18+,20-/m1/s1 |
| InChIKey | MWZOULASPWUGJJ-PHXBYCTMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Application: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| JMV 390-1 (CHEBI:39488) has role non-narcotic analgesic (CHEBI:35481) |
| JMV 390-1 (CHEBI:39488) has role protease inhibitor (CHEBI:37670) |
| JMV 390-1 (CHEBI:39488) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| N-[(2R)-2-benzyl-4-(hydroxyamino)-4-oxobutanoyl]-L-isoleucyl-L-leucine |
| Synonyms | Source |
|---|---|
| N-[(2R)-2-BENZYL-4-(HYDROXYAMINO)-4-OXOBUTANOYL]-L-ISOLEUCYL-L-LEUCINE | PDBeChem |
| N-(3-((Hydroxyamino)carbonyl)-2-benzyl-1-oxoprolyl)-L-isoleucine-L-leucine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 002 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| CAS:148473-36-3 | ChemIDplus |