EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O8 |
| Net Charge | 0 |
| Average Mass | 532.674 |
| Monoisotopic Mass | 532.30362 |
| SMILES | [H][C@@]12CC=C3C(C)(C)C(=O)C(O)=C[C@@]3([H])[C@]1(C)C(=O)C[C@@]1(C)[C@@]2(C)C[C@@H](O)[C@]1([H])[C@@](C)(O)C(=O)C[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C30H44O8/c1-25(2)15-9-10-19-27(5)13-18(32)23(30(8,38)21(34)12-20(33)26(3,4)37)28(27,6)14-22(35)29(19,7)16(15)11-17(31)24(25)36/h9,11,16,18-20,23,31-33,37-38H,10,12-14H2,1-8H3/t16-,18-,19+,20-,23+,27+,28-,29+,30+/m1/s1 |
| InChIKey | FBGLZDYMEULGSX-CQPOVTOMSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cucurbitacin J (CHEBI:3948) has role plant metabolite (CHEBI:76924) |
| cucurbitacin J (CHEBI:3948) is a cucurbitacin (CHEBI:16219) |
| cucurbitacin J (CHEBI:3948) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| Incoming Relation(s) |
| cucurbitacin J 2-O-β-D-glucopyranoside (CHEBI:68913) has functional parent cucurbitacin J (CHEBI:3948) |
| IUPAC Name |
|---|
| (4R,9β,16α,24R)-2,16,20,24,25-pentahydroxy-9,10,14-trimethyl-4,9-cyclo-9,10-secocholesta-2,5-diene-1,11,22-trione |
| Manual Xrefs | Databases |
|---|---|
| C08801 | KEGG COMPOUND |
| LMST01010111 | LIPID MAPS |
| C00003690 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9104858 | Reaxys |
| CAS:5979-41-9 | KEGG COMPOUND |