EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H24N4O3S |
| Net Charge | 0 |
| Average Mass | 316.427 |
| Monoisotopic Mass | 316.15691 |
| SMILES | CC(C)(C)NC[C@@H](O)COc1nsnc1N1CCOCC1 |
| InChI | InChI=1S/C13H24N4O3S/c1-13(2,3)14-8-10(18)9-20-12-11(15-21-16-12)17-4-6-19-7-5-17/h10,14,18H,4-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | BLJRIMJGRPQVNF-SNVBAGLBSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-timolol (CHEBI:39466) is a timolol (CHEBI:39465) |
| (R)-timolol (CHEBI:39466) is enantiomer of (S)-timolol (anhydrous) (CHEBI:9599) |
| Incoming Relation(s) |
| (S)-timolol (anhydrous) (CHEBI:9599) is enantiomer of (R)-timolol (CHEBI:39466) |
| IUPAC Name |
|---|
| (2R)-1-(tert-butylamino)-3-[(4-morpholin-4-yl-1,2,5-thiadiazol-3-yl)oxy]propan-2-ol |
| Synonym | Source |
|---|---|
| (+)-timolol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-15524 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5292185 | Reaxys |