EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H38O5 |
| Net Charge | 0 |
| Average Mass | 382.541 |
| Monoisotopic Mass | 382.27192 |
| SMILES | CCCCCCCC(=O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C22H38O5/c1-2-3-4-5-8-11-17(23)14-15-19-18(20(24)16-21(19)25)12-9-6-7-10-13-22(26)27/h6,9,18-21,24-25H,2-5,7-8,10-16H2,1H3,(H,26,27)/b9-6-/t18-,19-,20+,21-/m1/s1 |
| InChIKey | TVHAZVBUYQMHBC-SNHXEXRGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| unoprostone (CHEBI:39455) has role antiglaucoma drug (CHEBI:39456) |
| unoprostone (CHEBI:39455) has role antihypertensive agent (CHEBI:35674) |
| unoprostone (CHEBI:39455) is a ketone (CHEBI:17087) |
| unoprostone (CHEBI:39455) is a oxo monocarboxylic acid (CHEBI:35871) |
| unoprostone (CHEBI:39455) is a prostaglandins Fα (CHEBI:36066) |
| Incoming Relation(s) |
| isopropyl unoprostone (CHEBI:31731) has functional parent unoprostone (CHEBI:39455) |
| IUPAC Name |
|---|
| (5Z,9α,11α)-9,11-dihydroxy-15-oxo-20a,20b-dihomoprost-5-en-1-oic acid |
| INN | Source |
|---|---|
| unoprostone | ChemIDplus |
| Synonyms | Source |
|---|---|
| 13,14-dihydro-15-keto-20-ethyl PGF2α | ChEBI |
| (5Z)-7-[(1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl]hept-5-enoic acid | IUPAC |
| (+)-(Z)-7-((1R,2R,3R,5S)-3,5-dihydroxy-2-(3-oxodecyl)cyclopentyl)-5-heptenoic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Unoprostone | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9363775 | Reaxys |
| CAS:120373-36-6 | ChemIDplus |