EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5F12 |
| Net Charge | 0 |
| Average Mass | 288.031 |
| Monoisotopic Mass | 287.98084 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5F12/c6-1(7,2(8,9)4(12,13)14)3(10,11)5(15,16)17 |
| InChIKey | NJCBUSHGCBERSK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluoropentane (CHEBI:39428) has parent hydride pentane (CHEBI:37830) |
| perfluoropentane (CHEBI:39428) has role radioopaque medium (CHEBI:37338) |
| perfluoropentane (CHEBI:39428) has role ultrasound contrast agent (CHEBI:37337) |
| perfluoropentane (CHEBI:39428) is a fluoroalkane (CHEBI:24067) |
| perfluoropentane (CHEBI:39428) is a fluorocarbon (CHEBI:38824) |
| IUPAC Name |
|---|
| dodecafluoropentane |
| INNs | Source |
|---|---|
| perflenapent | WHO MedNet |
| perflénapent | WHO MedNet |
| perflenapent | WHO MedNet |
| perflenapentum | WHO MedNet |
| Synonyms | Source |
|---|---|
| n-perfluoropentane | NIST Chemistry WebBook |
| perfluoro-n-pentane | NIST Chemistry WebBook |
| NVX-108 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4685 | DrugCentral |
| Perflenapent | Wikipedia |
| D05436 | KEGG DRUG |
| Citations |
|---|