EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6F14 |
| Net Charge | 0 |
| Average Mass | 338.038 |
| Monoisotopic Mass | 337.97765 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6F14/c7-1(8,3(11,12)5(15,16)17)2(9,10)4(13,14)6(18,19)20 |
| InChIKey | ZJIJAJXFLBMLCK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | |
| Applications: | radioopaque medium A substance having the property of absorbing, and therefore being opaque to, electromagnetic radiation, particularly X-rays. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorohexane (CHEBI:39427) has parent hydride hexane (CHEBI:29021) |
| perfluorohexane (CHEBI:39427) has role non-polar solvent (CHEBI:48355) |
| perfluorohexane (CHEBI:39427) has role radioopaque medium (CHEBI:37338) |
| perfluorohexane (CHEBI:39427) is a fluoroalkane (CHEBI:24067) |
| perfluorohexane (CHEBI:39427) is a fluorocarbon (CHEBI:38824) |
| perfluorohexane (CHEBI:39427) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| tetradecafluorohexane |
| Synonyms | Source |
|---|---|
| n-tetradecafluorohexane | ChemIDplus |
| Perflexane | ChemIDplus |
| n-perfluorohexane | NIST Chemistry WebBook |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,6-tetradecafluorohexane | NIST Chemistry WebBook |
| Perfluorohexane | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Perfluorohexane | Wikipedia |
| 3429 | DrugCentral |