EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39426 - perfluorobutyric acid
| Formula | C4HF7O2 |
| Net Charge | 0 |
| Average Mass | 214.036 |
| Monoisotopic Mass | 213.98648 |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF7O2/c5-2(6,1(12)13)3(7,8)4(9,10)11/h(H,12,13) |
| InChIKey | YPJUNDFVDDCYIH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | chromatographic reagent A reagent used to improve selectivity in chromatographic analyses or separations, e.g. by formation of a derivative or by modification of the mobile phase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| perfluorobutyric acid (CHEBI:39426) has functional parent butyric acid (CHEBI:30772) |
| perfluorobutyric acid (CHEBI:39426) has role chromatographic reagent (CHEBI:59745) |
| perfluorobutyric acid (CHEBI:39426) has role environmental contaminant (CHEBI:78298) |
| perfluorobutyric acid (CHEBI:39426) has role xenobiotic (CHEBI:35703) |
| perfluorobutyric acid (CHEBI:39426) is a fluoroalkanoic acid (CHEBI:35551) |
| IUPAC Name |
|---|
| heptafluorobutanoic acid |
| Synonyms | Source |
|---|---|
| Perfluoropropanecarboxylic acid | ChemIDplus |
| Perfluorobutanoic acid | ChemIDplus |
| Heptafluoro-1-butanoic acid | ChemIDplus |
| Heptafluorobutyric acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Heptafluorobutyric_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1426882 | Reaxys |
| CAS:375-22-4 | ChemIDplus |
| Citations |
|---|