EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7ClF5O |
| Net Charge | 0 |
| Average Mass | 230.519 |
| Monoisotopic Mass | 229.95578 |
| SMILES | O=C(Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C7ClF5O/c8-7(14)1-2(9)4(11)6(13)5(12)3(1)10 |
| InChIKey | MYHOHFDYWMPGJY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | chromatographic reagent A reagent used to improve selectivity in chromatographic analyses or separations, e.g. by formation of a derivative or by modification of the mobile phase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentafluorobenzoyl chloride (CHEBI:39425) has functional parent pentafluorobenzoic acid (CHEBI:46796) |
| pentafluorobenzoyl chloride (CHEBI:39425) has role chromatographic reagent (CHEBI:59745) |
| pentafluorobenzoyl chloride (CHEBI:39425) is a acyl chloride (CHEBI:36687) |
| pentafluorobenzoyl chloride (CHEBI:39425) is a perfluorinated compound (CHEBI:134091) |
| IUPAC Name |
|---|
| pentafluorobenzoyl chloride |
| Synonym | Source |
|---|---|
| 2,3,4,5,6-pentafluorobenzoyl chloride | ChEBI |