EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8F14O3 |
| Net Charge | 0 |
| Average Mass | 410.057 |
| Monoisotopic Mass | 409.96239 |
| SMILES | O=C(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8F14O3/c9-3(10,5(13,14)7(17,18)19)1(23)25-2(24)4(11,12)6(15,16)8(20,21)22 |
| InChIKey | UFFSXJKVKBQEHC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | chromatographic reagent A reagent used to improve selectivity in chromatographic analyses or separations, e.g. by formation of a derivative or by modification of the mobile phase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heptafluorobutyric anhydride (CHEBI:39424) has functional parent butyric acid (CHEBI:30772) |
| heptafluorobutyric anhydride (CHEBI:39424) has role chromatographic reagent (CHEBI:59745) |
| heptafluorobutyric anhydride (CHEBI:39424) is a acyclic carboxylic anhydride (CHEBI:36631) |
| heptafluorobutyric anhydride (CHEBI:39424) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| heptafluorobutanoic anhydride |
| Synonym | Source |
|---|---|
| HFBA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:856036 | Beilstein |
| CAS:336-59-4 | ChemIDplus |