EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H46O9 |
| Net Charge | 0 |
| Average Mass | 574.711 |
| Monoisotopic Mass | 574.31418 |
| SMILES | [H][C@@]12CC=C3C(C)(C)C(=O)[C@@H](O)C[C@@]3([H])[C@]1(CO)C(=O)C[C@@]1(C)[C@@]2(C)C[C@@H](O)[C@]1([H])[C@@](C)(O)C(=O)/C=C/C(C)(C)OC(C)=O |
| InChI | InChI=1S/C32H46O9/c1-17(34)41-27(2,3)12-11-23(37)31(8,40)25-21(36)14-29(6)22-10-9-18-19(13-20(35)26(39)28(18,4)5)32(22,16-33)24(38)15-30(25,29)7/h9,11-12,19-22,25,33,35-36,40H,10,13-16H2,1-8H3/b12-11+/t19-,20+,21-,22+,25+,29+,30-,31+,32+/m1/s1 |
| InChIKey | IHTCCHVMPGDDSL-IVNGUWCNSA-N |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cucurbitacin A (CHEBI:3940) is a cucurbitacin (CHEBI:16219) |
| Synonym | Source |
|---|---|
| Cucurbitacin A | KEGG COMPOUND |