EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H14ClF7O2 |
| Net Charge | 0 |
| Average Mass | 418.736 |
| Monoisotopic Mass | 418.05705 |
| SMILES | Cc1c(F)c(F)c(COC(=O)[C@@H]2[C@H](/C=C(\Cl)C(F)(F)F)C2(C)C)c(F)c1F |
| InChI | InChI=1S/C17H14ClF7O2/c1-6-11(19)13(21)7(14(22)12(6)20)5-27-15(26)10-8(16(10,2)3)4-9(18)17(23,24)25/h4,8,10H,5H2,1-3H3/b9-4-/t8-,10-/m0/s1 |
| InChIKey | ZFHGXWPMULPQSE-UKSCLKOJSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-(1R)-cis-tefluthrin (CHEBI:39395) is a 2,3,5,6-tetrafluoro-4-methylbenzyl 3-[(1Z)-2-chloro-3,3,3-trifluoroprop-1-en-1-yl]-2,2-dimethylcyclopropanecarboxylate (CHEBI:78107) |
| (Z)-(1R)-cis-tefluthrin (CHEBI:39395) is enantiomer of (Z)-(1S)-cis-tefluthrin (CHEBI:78106) |
| Incoming Relation(s) |
| tefluthrin (CHEBI:9430) has part (Z)-(1R)-cis-tefluthrin (CHEBI:39395) |
| (Z)-(1S)-cis-tefluthrin (CHEBI:78106) is enantiomer of (Z)-(1R)-cis-tefluthrin (CHEBI:39395) |
| IUPAC Name |
|---|
| 2,3,5,6-tetrafluoro-4-methylbenzyl (1R,3R)-3-[(1Z)-2-chloro-3,3,3-trifluoroprop-1-en-1-yl]-2,2-dimethylcyclopropanecarboxylate |
| Manual Xrefs | Databases |
|---|---|
| 3090 | PPDB |