EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H17NO3S |
| Net Charge | 0 |
| Average Mass | 207.295 |
| Monoisotopic Mass | 207.09291 |
| SMILES | CC(C)(CCO)SC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H17NO3S/c1-8(2,3-4-10)13-5-6(9)7(11)12/h6,10H,3-5,9H2,1-2H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | IFERABFGYYJODC-LURJTMIESA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Felis catus (ncbitaxon:9685) | urine (BTO:0001419) | PubMed (8587953) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| felinine (CHEBI:39390) has role mammalian metabolite (CHEBI:75768) |
| felinine (CHEBI:39390) has role pheromone (CHEBI:26013) |
| felinine (CHEBI:39390) is a L-cysteine thioether (CHEBI:27532) |
| felinine (CHEBI:39390) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| felinine (CHEBI:39390) is tautomer of felinine zwitterion (CHEBI:156141) |
| Incoming Relation(s) |
| felinine zwitterion (CHEBI:156141) is tautomer of felinine (CHEBI:39390) |
| IUPAC Name |
|---|
| S-(4-hydroxy-2-methylbutan-2-yl)-L-cysteine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-[(4-hydroxy-2-methylbutan-2-yl)sulfanyl]propanoic acid | IUPAC |
| S-(3-hydroxy-1,1-dimethylpropyl)-L-cysteine | ChemIDplus |
| (−)-felinine | ChEBI |
| Citations |
|---|