EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H6Cl2F4N2O2 |
| Net Charge | 0 |
| Average Mass | 381.112 |
| Monoisotopic Mass | 379.97425 |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1cc(Cl)c(F)c(Cl)c1F |
| InChI | InChI=1S/C14H6Cl2F4N2O2/c15-5-4-8(12(20)10(16)11(5)19)21-14(24)22-13(23)9-6(17)2-1-3-7(9)18/h1-4H,(H2,21,22,23,24) |
| InChIKey | CJDWRQLODFKPEL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| teflubenzuron (CHEBI:39387) has functional parent N-benzoylurea (CHEBI:39416) |
| teflubenzuron (CHEBI:39387) has role environmental contaminant (CHEBI:78298) |
| teflubenzuron (CHEBI:39387) has role insecticide (CHEBI:24852) |
| teflubenzuron (CHEBI:39387) has role xenobiotic (CHEBI:35703) |
| teflubenzuron (CHEBI:39387) is a N-acylurea (CHEBI:74266) |
| teflubenzuron (CHEBI:39387) is a dichlorobenzene (CHEBI:23697) |
| teflubenzuron (CHEBI:39387) is a difluorobenzene (CHEBI:38582) |
| IUPAC Name |
|---|
| N-[(3,5-dichloro-2,4-difluorophenyl)carbamoyl]-2,6-difluorobenzamide |
| Synonyms | Source |
|---|---|
| Teflubenzuron | ChemIDplus |
| N-{[(3,5-dichloro-2,4-difluorophenyl)amino]carbonyl}-2,6-difluorobenzamide | IUPAC |
| 1-(3,5-dichloro-2,4-difluorophenyl)-3-(2,6-difluorobenzoyl)urea | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C18437 | KEGG COMPOUND |
| teflubenzuron | Alan Wood's Pesticides |
| 616 | PPDB |
| 616 | VSDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8229925 | Reaxys |
| CAS:99039-56-2 | ChemIDplus |
| CAS:83121-18-0 | ChemIDplus |
| CAS:83121-18-0 | KEGG COMPOUND |
| Citations |
|---|