EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H8Cl2F6N2O3 |
| Net Charge | 0 |
| Average Mass | 461.145 |
| Monoisotopic Mass | 459.98162 |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1cc(Cl)c(OC(F)(F)C(F)F)c(Cl)c1 |
| InChI | InChI=1S/C16H8Cl2F6N2O3/c17-7-4-6(5-8(18)12(7)29-16(23,24)14(21)22)25-15(28)26-13(27)11-9(19)2-1-3-10(11)20/h1-5,14H,(H2,25,26,27,28) |
| InChIKey | RGNPBRKPHBKNKX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hexaflumuron (CHEBI:39383) is a N-acylurea (CHEBI:74266) |
| hexaflumuron (CHEBI:39383) is a aromatic ether (CHEBI:35618) |
| hexaflumuron (CHEBI:39383) is a benzoylurea insecticide (CHEBI:38494) |
| hexaflumuron (CHEBI:39383) is a dichlorobenzene (CHEBI:23697) |
| hexaflumuron (CHEBI:39383) is a organochlorine insecticide (CHEBI:25705) |
| hexaflumuron (CHEBI:39383) is a organofluorine insecticide (CHEBI:38804) |
| IUPAC Name |
|---|
| N-({[3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl]amino}carbonyl)-2,6-difluorobenzamide |
| Synonyms | Source |
|---|---|
| 1-(3,5-dichloro-4-(1,1,2,2-tetrafluoroethoxy)phenyl)-3-(2,6-difluorobenzoyl)urea | ChemIDplus |
| Hexaflumuron | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 383 | PPDB |
| C18861 | KEGG COMPOUND |
| hexaflumuron | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:86479-06-3 | ChemIDplus |
| CAS:86479-06-3 | KEGG COMPOUND |