EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N3OS |
| Net Charge | 0 |
| Average Mass | 305.447 |
| Monoisotopic Mass | 305.15618 |
| SMILES | CC(C)N1C(=O)N(c2ccccc2)CS/C1=N\C(C)(C)C |
| InChI | InChI=1S/C16H23N3OS/c1-12(2)19-14(17-16(3,4)5)21-11-18(15(19)20)13-9-7-6-8-10-13/h6-10,12H,11H2,1-5H3/b17-14- |
| InChIKey | PRLVTUNWOQKEAI-VKAVYKQESA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| buprofezin (CHEBI:39381) has role homopteran inhibitor of chitin biosynthesis (CHEBI:39378) |
| buprofezin (CHEBI:39381) has role insecticide (CHEBI:24852) |
| buprofezin (CHEBI:39381) is a 2-(tert-butylimino)-5-phenyl-3-(propan-2-yl)-1,3,5-thiadiazinan-4-one (CHEBI:3218) |
| IUPAC Name |
|---|
| (2Z)-2-(tert-butylimino)-5-phenyl-3-(propan-2-yl)-1,3,5-thiadiazinan-4-one |
| Synonyms | Source |
|---|---|
| (2Z)-2-(tert-butylimino)-3-isopropyl-5-phenyl-1,3,5-thiadiazinan-4-one | IUPAC |
| (Z)-buprofezin | ChEBI |
| (Z)-2-tert-butylimino-3-isopropyl-5-phenyl-1,3,5-thiadiazinan-4-one | Alan Wood's Pesticides |
| (Z)-2-[(1,1-dimethylethyl)imino]tetrahydro-3-(1-methylethyl)-5-phenyl-4H-1,3,5-thiadiazin-4-one | Alan Wood's Pesticides |
| Manual Xrefs | Databases |
|---|---|
| C10912 | KEGG COMPOUND |
| buprofezin | Alan Wood's Pesticides |
| 100 | PPDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8625926 | Beilstein |
| CAS:69327-76-0 | KEGG COMPOUND |
| CAS:953030-84-7 | Alan Wood's Pesticides |