EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6Cl2O3 |
| Net Charge | 0 |
| Average Mass | 221.039 |
| Monoisotopic Mass | 219.96940 |
| SMILES | O=C(O)COc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H6Cl2O3/c9-6-2-1-5(3-7(6)10)13-4-8(11)12/h1-3H,4H2,(H,11,12) |
| InChIKey | SNYRXHULAWEECU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dichlorophenoxyacetic acid (CHEBI:393747) has role phenoxy herbicide (CHEBI:60575) |
| 3,4-dichlorophenoxyacetic acid (CHEBI:393747) is a chlorophenoxyacetic acid (CHEBI:23152) |
| IUPAC Name |
|---|
| (3,4-dichlorophenoxy)acetic acid |
| Synonym | Source |
|---|---|
| 3,4-DA | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1969638 | Reaxys |
| CAS:588-22-7 | ChemIDplus |