EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H10Cl2F5N3O3 |
| Net Charge | 0 |
| Average Mass | 506.214 |
| Monoisotopic Mass | 505.00194 |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(Cl)c(Oc2ncc(C(F)(F)F)cc2Cl)c1 |
| InChI | InChI=1S/C20H10Cl2F5N3O3/c21-11-5-4-10(29-19(32)30-17(31)16-13(23)2-1-3-14(16)24)7-15(11)33-18-12(22)6-9(8-28-18)20(25,26)27/h1-8H,(H2,29,30,31,32) |
| InChIKey | YOWNVPAUWYHLQX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fluazuron (CHEBI:39374) has role acaricide (CHEBI:22153) |
| fluazuron (CHEBI:39374) has role mite growth regulator (CHEBI:39316) |
| fluazuron (CHEBI:39374) is a N-acylurea (CHEBI:74266) |
| fluazuron (CHEBI:39374) is a aromatic ether (CHEBI:35618) |
| fluazuron (CHEBI:39374) is a chloropyridine (CHEBI:39173) |
| fluazuron (CHEBI:39374) is a monochlorobenzenes (CHEBI:83403) |
| fluazuron (CHEBI:39374) is a organochlorine acaricide (CHEBI:38657) |
| fluazuron (CHEBI:39374) is a organofluorine acaricide (CHEBI:38806) |
| fluazuron (CHEBI:39374) is a phenylureas (CHEBI:134043) |
| IUPAC Name |
|---|
| N-[(4-chloro-3-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenyl)carbamoyl]-2,6-difluorobenzamide |
| Synonyms | Source |
|---|---|
| 1-(4-chloro-3-((3-chloro-5-(trifluoromethyl)-2-pyridyl)oxy)phenyl)-3-(2,6-difluorobenzoyl)urea | ChemIDplus |
| Fluazuron | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:86811-58-7 | ChemIDplus |
| CAS:86811-58-7 | Alan Wood's Pesticides |