EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39370 - chlorfluazuron
| Formula | C20H9Cl3F5N3O3 |
| Net Charge | 0 |
| Average Mass | 540.659 |
| Monoisotopic Mass | 538.96297 |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1cc(Cl)c(Oc2ncc(C(F)(F)F)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H9Cl3F5N3O3/c21-10-5-9(30-19(33)31-17(32)15-13(24)2-1-3-14(15)25)6-11(22)16(10)34-18-12(23)4-8(7-29-18)20(26,27)28/h1-7H,(H2,30,31,32,33) |
| InChIKey | UISUNVFOGSJSKD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorfluazuron (CHEBI:39370) is a benzoylurea insecticide (CHEBI:38494) |
| chlorfluazuron (CHEBI:39370) is a dichlorobenzene (CHEBI:23697) |
| chlorfluazuron (CHEBI:39370) is a organochlorine insecticide (CHEBI:25705) |
| chlorfluazuron (CHEBI:39370) is a organofluorine insecticide (CHEBI:38804) |
| IUPAC Name |
|---|
| N-[(3,5-dichloro-4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenyl)carbamoyl]-2,6-difluorobenzamide |
| Synonym | Source |
|---|---|
| Chlorfluazuron | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8369967 | Beilstein |
| CAS:71422-67-8 | ChemIDplus |
| CAS:71422-67-8 | KEGG COMPOUND |