EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13N3O6 |
| Net Charge | 0 |
| Average Mass | 283.240 |
| Monoisotopic Mass | 283.08044 |
| SMILES | O=C(O)CC[C@]1(C(=O)O)N[C@H](C(=O)O)Cc2ncnc21 |
| InChI | InChI=1S/C11H13N3O6/c15-7(16)1-2-11(10(19)20)8-5(12-4-13-8)3-6(14-11)9(17)18/h4,6,14H,1-3H2,(H,12,13)(H,15,16)(H,17,18)(H,19,20)/t6-,11-/m0/s1 |
| InChIKey | XGCZNSAJOHDWQS-KGFZYKRKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cucumopine (CHEBI:3937) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Synonym | Source |
|---|---|
| Cucumopine | KEGG COMPOUND |