EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:39361 - flumethrin
| Formula | C28H22Cl2FNO3 |
| Net Charge | 0 |
| Average Mass | 510.392 |
| Monoisotopic Mass | 509.09608 |
| SMILES | CC1(C)C(C=C(Cl)c2ccc(Cl)cc2)C1C(=O)OC(C#N)c1ccc(F)c(Oc2ccccc2)c1 |
| InChI | InChI=1S/C28H22Cl2FNO3/c1-28(2)21(15-22(30)17-8-11-19(29)12-9-17)26(28)27(33)35-25(16-32)18-10-13-23(31)24(14-18)34-20-6-4-3-5-7-20/h3-15,21,25-26H,1-2H3 |
| InChIKey | YXWCBRDRVXHABN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flumethrin (CHEBI:39361) has role pyrethroid ester acaricide (CHEBI:39259) |
| flumethrin (CHEBI:39361) has role pyrethroid ester insecticide (CHEBI:39116) |
| flumethrin (CHEBI:39361) is a monochlorobenzenes (CHEBI:83403) |
| flumethrin (CHEBI:39361) is a organochlorine acaricide (CHEBI:38657) |
| flumethrin (CHEBI:39361) is a organofluorine acaricide (CHEBI:38806) |
| IUPAC Name |
|---|
| cyano(4-fluoro-3-phenoxyphenyl)methyl 3-[2-chloro-2-(4-chlorophenyl)ethenyl]-2,2-dimethylcyclopropanecarboxylate |
| Manual Xrefs | Databases |
|---|---|
| 1480 | VSDB |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2925940 | Beilstein |
| CAS:69770-45-2 | ChemIDplus |