EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H6Cl4O2S |
| Net Charge | 0 |
| Average Mass | 356.057 |
| Monoisotopic Mass | 353.88426 |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H6Cl4O2S/c13-7-1-3-8(4-2-7)19(17,18)12-6-10(15)9(14)5-11(12)16/h1-6H |
| InChIKey | MLGCXEBRWGEOQX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tetradifon (CHEBI:39330) is a monochlorobenzenes (CHEBI:83403) |
| tetradifon (CHEBI:39330) is a organochlorine acaricide (CHEBI:38657) |
| tetradifon (CHEBI:39330) is a sulfone (CHEBI:35850) |
| tetradifon (CHEBI:39330) is a trichlorobenzene (CHEBI:27096) |
| IUPAC Names |
|---|
| 1,2,4-trichloro-5-[(4-chlorophenyl)sulfonyl]benzene |
| 4-chlorophenyl 2,4,5-trichlorophenyl sulfone |
| Synonyms | Source |
|---|---|
| 2,4,5,4'-tetrachlorodiphenyl sulfone | ChemIDplus |
| Tetradifon | ChemIDplus |