EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23F2NO2 |
| Net Charge | 0 |
| Average Mass | 359.416 |
| Monoisotopic Mass | 359.16969 |
| SMILES | CCOc1cc(C(C)(C)C)ccc1C1COC(c2c(F)cccc2F)=N1 |
| InChI | InChI=1S/C21H23F2NO2/c1-5-25-18-11-13(21(2,3)4)9-10-14(18)17-12-26-20(24-17)19-15(22)7-6-8-16(19)23/h6-11,17H,5,12H2,1-4H3 |
| InChIKey | IXSZQYVWNJNRAL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etoxazole (CHEBI:39329) is a organofluorine acaricide (CHEBI:38806) |
| IUPAC Name |
|---|
| 4-(4-tert-butyl-2-ethoxyphenyl)-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| Synonyms | Source |
|---|---|
| 2-(2,6-difluorophenyl)-4-(4-(1,1-dimethylethyl)-2-ethoxyphenyl)-4,5-dihydrooxazole | ChemIDplus |
| Etoxazole | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8930214 | Beilstein |
| CAS:153233-91-1 | ChemIDplus |
| CAS:153233-91-1 | KEGG COMPOUND |