EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21ClN2O2S |
| Net Charge | 0 |
| Average Mass | 352.887 |
| Monoisotopic Mass | 352.10123 |
| SMILES | C[C@H]1[C@H](c2ccc(Cl)cc2)SC(=O)N1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H21ClN2O2S/c1-11-15(12-7-9-13(18)10-8-12)23-17(22)20(11)16(21)19-14-5-3-2-4-6-14/h7-11,14-15H,2-6H2,1H3,(H,19,21)/t11-,15+/m0/s1 |
| InChIKey | XGWIJUOSCAQSSV-XHDPSFHLSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S,S)-hexythiazox (CHEBI:39328) is a hexythiazox (CHEBI:39326) |
| IUPAC Name |
|---|
| (4S,5S)-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| C18467 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9001643 | Beilstein |
| CAS:78587-05-0 | KEGG COMPOUND |