EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H27NO3 |
| Net Charge | 0 |
| Average Mass | 377.484 |
| Monoisotopic Mass | 377.19909 |
| SMILES | [H][C@]12CCCCN1Cc1c(c3cc(OC)c(OC)cc3c3cc(OC)ccc13)C2 |
| InChI | InChI=1S/C24H27NO3/c1-26-16-7-8-17-19(11-16)21-13-24(28-3)23(27-2)12-20(21)18-10-15-6-4-5-9-25(15)14-22(17)18/h7-8,11-13,15H,4-6,9-10,14H2,1-3H3/t15-/m1/s1 |
| InChIKey | RSHYSOGXGSUUIJ-OAHLLOKOSA-N |
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cryptopleurine (CHEBI:3932) has role antineoplastic agent (CHEBI:35610) |
| cryptopleurine (CHEBI:3932) has role antiviral agent (CHEBI:22587) |
| cryptopleurine (CHEBI:3932) has role protein synthesis inhibitor (CHEBI:48001) |
| cryptopleurine (CHEBI:3932) is a alkaloid (CHEBI:22315) |
| cryptopleurine (CHEBI:3932) is a alkaloid antibiotic (CHEBI:86322) |
| cryptopleurine (CHEBI:3932) is a aromatic ether (CHEBI:35618) |
| cryptopleurine (CHEBI:3932) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (14aR)-2,3,6-trimethoxy-11,12,13,14,14a,15-hexahydro-9H-dibenzo[f,h]pyrido[1,2-b]isoquinoline |
| Synonym | Source |
|---|---|
| 11,12,13,14,14a,15-Hexahydro-2,3,6-trimethoxy-9H-phenanthro(9,10-b)quinolizine | ChemIDplus |
| Citations |
|---|