EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10ClF3O2 |
| Net Charge | 0 |
| Average Mass | 242.624 |
| Monoisotopic Mass | 242.03214 |
| SMILES | CC1(C)C(C=C(Cl)C(F)(F)F)C1C(=O)O |
| InChI | InChI=1S/C9H10ClF3O2/c1-8(2)4(6(8)7(14)15)3-5(10)9(11,12)13/h3-4,6H,1-2H3,(H,14,15) |
| InChIKey | SPVZAYWHHVLPBN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid (CHEBI:39319) has functional parent cyclopropanecarboxylic acid (CHEBI:23500) |
| 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid (CHEBI:39319) is a monocarboxylic acid (CHEBI:25384) |
| 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid (CHEBI:39319) is a organochlorine compound (CHEBI:36683) |
| 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid (CHEBI:39319) is a organofluorine compound (CHEBI:37143) |
| Incoming Relation(s) |
| cyhalothrin (CHEBI:4035) has functional parent 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid (CHEBI:39319) |
| IUPAC Name |
|---|
| 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid |
| Synonym | Source |
|---|---|
| 3-(2-chloro-3,3,3-trifluoroprop-1-en-1-yl)-2,2-dimethylcyclopropanecarboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1969652 | Reaxys |
| CAS:74609-46-4 | ChemIDplus |