EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8Cl2N4 |
| Net Charge | 0 |
| Average Mass | 303.152 |
| Monoisotopic Mass | 302.01260 |
| SMILES | Clc1ccccc1-c1nnc(-c2ccccc2Cl)nn1 |
| InChI | InChI=1S/C14H8Cl2N4/c15-11-7-3-1-5-9(11)13-17-19-14(20-18-13)10-6-2-4-8-12(10)16/h1-8H |
| InChIKey | UXADOQPNKNTIHB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofentezine (CHEBI:39315) has parent hydride 1,2,4,5-tetrazine (CHEBI:39320) |
| clofentezine (CHEBI:39315) has role mite growth regulator (CHEBI:39316) |
| clofentezine (CHEBI:39315) has role tetrazine acaricide (CHEBI:39318) |
| clofentezine (CHEBI:39315) is a monochlorobenzenes (CHEBI:83403) |
| clofentezine (CHEBI:39315) is a organochlorine acaricide (CHEBI:38657) |
| clofentezine (CHEBI:39315) is a tetrazine (CHEBI:39321) |
| IUPAC Name |
|---|
| 3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine |
| Synonyms | Source |
|---|---|
| 3,6-bis(o-chlorophenyl)-1,2,4,5-tetrazine | ChemIDplus |
| Apollo | ChemIDplus |
| Bisclofentazin | ChemIDplus |
| Bisclofentazine | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7137128 | Beilstein |
| CAS:74115-24-5 | ChemIDplus |
| CAS:74115-24-5 | KEGG COMPOUND |