EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12N2 |
| Net Charge | 0 |
| Average Mass | 232.286 |
| Monoisotopic Mass | 232.10005 |
| SMILES | Cn1c2c3ccccc3nc-2cc2ccccc21 |
| InChI | InChI=1S/C16H12N2/c1-18-15-9-5-2-6-11(15)10-14-16(18)12-7-3-4-8-13(12)17-14/h2-10H,1H3 |
| InChIKey | KURWKDDWCJELSV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. cysteine protease inhibitor Any protease inhibitor that restricts the action of a cysteine protease. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cryptolepine (CHEBI:3930) has role anti-inflammatory agent (CHEBI:67079) |
| cryptolepine (CHEBI:3930) has role antimalarial (CHEBI:38068) |
| cryptolepine (CHEBI:3930) has role antineoplastic agent (CHEBI:35610) |
| cryptolepine (CHEBI:3930) has role cysteine protease inhibitor (CHEBI:64152) |
| cryptolepine (CHEBI:3930) has role plant metabolite (CHEBI:76924) |
| cryptolepine (CHEBI:3930) is a indole alkaloid (CHEBI:38958) |
| cryptolepine (CHEBI:3930) is a organic heterotetracyclic compound (CHEBI:38163) |
| cryptolepine (CHEBI:3930) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| IUPAC Name |
|---|
| 5-methyl-5H-indolo[3,2-b]quinoline |
| Synonym | Source |
|---|---|
| CCRIS 9019 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C09142 | KEGG COMPOUND |
| DR1 | PDBeChem |
| Cryptolepine | Wikipedia |
| C00001710 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15814 | Reaxys |
| CAS:480-26-2 | KEGG COMPOUND |
| CAS:480-26-2 | ChemIDplus |
| Citations |
|---|