EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17290 - (S)-3-hydroxybutyric acid
| Formula | C4H8O3 |
| Net Charge | 0 |
| Average Mass | 104.105 |
| Monoisotopic Mass | 104.04734 |
| SMILES | C[C@H](O)CC(=O)O |
| InChI | InChI=1S/C4H8O3/c1-3(5)2-4(6)7/h3,5H,2H2,1H3,(H,6,7)/t3-/m0/s1 |
| InChIKey | WHBMMWSBFZVSSR-VKHMYHEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3-hydroxybutyric acid (CHEBI:17290) is a 3-hydroxybutyric acid (CHEBI:20067) |
| (S)-3-hydroxybutyric acid (CHEBI:17290) is conjugate acid of (S)-3-hydroxybutyrate (CHEBI:11047) |
| (S)-3-hydroxybutyric acid (CHEBI:17290) is enantiomer of (R)-3-hydroxybutyric acid (CHEBI:17066) |
| Incoming Relation(s) |
| (S)-3-hydroxybutanoyl-CoA (CHEBI:15453) has functional parent (S)-3-hydroxybutyric acid (CHEBI:17290) |
| (S)-3-hydroxybutyrate (CHEBI:11047) is conjugate base of (S)-3-hydroxybutyric acid (CHEBI:17290) |
| (R)-3-hydroxybutyric acid (CHEBI:17066) is enantiomer of (S)-3-hydroxybutyric acid (CHEBI:17290) |
| IUPAC Name |
|---|
| (3S)-3-hydroxybutanoic acid |
| Synonyms | Source |
|---|---|
| (S)-3-Hydroxybutyric acid | ChemIDplus |
| (S)-3-hydroxybutyric acid | ChEBI |
| (S)-3HB | ChEBI |
| (+)-3-hydroxybutyric acid | ChEBI |
| (S)-3-hydroxybutanoic acid | ChEBI |
| L-(+)-3-hydroxybutyric acid | ChEBI |
| Citations |
|---|