EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H78OSn2 |
| Net Charge | 0 |
| Average Mass | 1052.705 |
| Monoisotopic Mass | 1054.40966 |
| SMILES | CC(C)([CH2][Sn]([CH2]C(C)(C)c1ccccc1)([CH2]C(C)(C)c1ccccc1)[O][Sn]([CH2]C(C)(C)c1ccccc1)([CH2]C(C)(C)c1ccccc1)[CH2]C(C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/6C10H13.O.2Sn/c6*1-10(2,3)9-7-5-4-6-8-9;;;/h6*4-8H,1H2,2-3H3;;; |
| InChIKey | HOXINJBQVZWYGZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fenbutatin oxide (CHEBI:39294) is a organotin acaricide (CHEBI:39292) |
| IUPAC Name |
|---|
| hexakis(2-methyl-2-phenylpropyl)distannoxane |
| Synonyms | Source |
|---|---|
| fenbutatin oxide | ChemIDplus |
| bis(tris(2-methyl-2-phenylpropyl)tin)oxide | ChemIDplus |
| hexakis(β,β-dimethylphenethyl)distannoxane | ChemIDplus |
| Torque | ChemIDplus |
| Vendex | ChemIDplus |
| SD 14114 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4097400 | Beilstein |
| Gmelin:27103 | Gmelin |
| Gmelin:1825781 | Gmelin |
| Gmelin:1585258 | Gmelin |
| CAS:13356-08-6 | NIST Chemistry WebBook |
| CAS:13356-08-6 | ChemIDplus |
| CAS:13356-08-6 | KEGG COMPOUND |