EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H6F3N3O |
| Net Charge | 0 |
| Average Mass | 229.161 |
| Monoisotopic Mass | 229.04630 |
| SMILES | N#CCNC(=O)c1cnccc1C(F)(F)F |
| InChI | InChI=1S/C9H6F3N3O/c10-9(11,12)7-1-3-14-5-6(7)8(16)15-4-2-13/h1,3,5H,4H2,(H,15,16) |
| InChIKey | RLQJEEJISHYWON-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | proinsecticide A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active insecticide for which it is a proinsecticide. antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| flonicamid (CHEBI:39291) has functional parent flumetnicam (CHEBI:231554) |
| flonicamid (CHEBI:39291) has role antifeedant (CHEBI:22583) |
| flonicamid (CHEBI:39291) has role environmental contaminant (CHEBI:78298) |
| flonicamid (CHEBI:39291) has role proinsecticide (CHEBI:136644) |
| flonicamid (CHEBI:39291) has role xenobiotic (CHEBI:35703) |
| flonicamid (CHEBI:39291) is a nitrile (CHEBI:18379) |
| flonicamid (CHEBI:39291) is a organofluorine compound (CHEBI:37143) |
| flonicamid (CHEBI:39291) is a pyridinecarboxamide (CHEBI:25529) |
| flonicamid (CHEBI:39291) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| N-(cyanomethyl)-4-(trifluoromethyl)nicotinamide |
| Synonym | Source |
|---|---|
| Flonicamid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 321 | PPDB |
| C18463 | KEGG COMPOUND |
| flonicamid | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343090 | Reaxys |
| CAS:158062-67-0 | ChemIDplus |
| CAS:158062-67-0 | KEGG COMPOUND |
| Citations |
|---|