EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H34O3 |
| Net Charge | 0 |
| Average Mass | 310.478 |
| Monoisotopic Mass | 310.25079 |
| SMILES | COC(C)(C)CCC[C@@H](C)C/C=C/C(C)=C/C(=O)OC(C)C |
| InChI | InChI=1S/C19H34O3/c1-15(2)22-18(20)14-17(4)11-8-10-16(3)12-9-13-19(5,6)21-7/h8,11,14-16H,9-10,12-13H2,1-7H3/b11-8+,17-14+/t16-/m0/s1 |
| InChIKey | NFGXHKASABOEEW-UQHDCKCOSA-N |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-methoprene (CHEBI:39256) is a methoprene (CHEBI:34839) |
| (R)-methoprene (CHEBI:39256) is enantiomer of (S)-methoprene (CHEBI:39255) |
| Incoming Relation(s) |
| (S)-methoprene (CHEBI:39255) is enantiomer of (R)-methoprene (CHEBI:39256) |
| IUPAC Name |
|---|
| propan-2-yl (2E,4E,7R)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate |
| Synonym | Source |
|---|---|
| isopropyl (2E,4E,7R)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4906391 | Beilstein |