EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26ClN3 |
| Net Charge | 0 |
| Average Mass | 319.880 |
| Monoisotopic Mass | 319.18153 |
| SMILES | CCN(CC)CCC[C@@H](C)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | WHTVZRBIWZFKQO-CQSZACIVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | autophagy inhibitor Any compound that inhibits the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-chloroquine (CHEBI:48811) is a chloroquine (CHEBI:3638) |
| (R)-chloroquine (CHEBI:48811) is enantiomer of (S)-chloroquine (CHEBI:39254) |
| Incoming Relation(s) |
| (S)-chloroquine (CHEBI:39254) is enantiomer of (R)-chloroquine (CHEBI:48811) |
| IUPAC Name |
|---|
| (4R)-N4-(7-chloroquinolin-4-yl)-N1,N1-diethylpentane-1,4-diamine |
| Synonyms | Source |
|---|---|
| (4R)-N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine | ChemIDplus |
| (−)-chloroquine | ChemIDplus |
| (−)-N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine | ChemIDplus |
| (R)-(−)-chloroquine | ChemIDplus |
| (R)-N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine | ChemIDplus |
| N4-(7-CHLORO-QUINOLIN-4-YL)-N1,N1-DIETHYL-PENTANE-1,4-DIAMINE | PDBeChem |
| Manual Xrefs | Databases |
|---|---|
| CLQ | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5051460 | Beilstein |
| CAS:58175-87-4 | ChemIDplus |