EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O2 |
| Net Charge | 0 |
| Average Mass | 242.403 |
| Monoisotopic Mass | 242.22458 |
| SMILES | CC(C)CCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H30O2/c1-14(2)12-10-8-6-4-3-5-7-9-11-13-15(16)17/h14H,3-13H2,1-2H3,(H,16,17) |
| InChIKey | ZOCYQVNGROEVLU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isopentadecanoic acid (CHEBI:39250) is a branched-chain saturated fatty acid (CHEBI:39417) |
| isopentadecanoic acid (CHEBI:39250) is a long-chain fatty acid (CHEBI:15904) |
| isopentadecanoic acid (CHEBI:39250) is a methyl-branched fatty acid (CHEBI:62499) |
| isopentadecanoic acid (CHEBI:39250) is conjugate acid of isopentadecanoate (CHEBI:70826) |
| Incoming Relation(s) |
| isopentadecanoyl-CoA (CHEBI:70848) has functional parent isopentadecanoic acid (CHEBI:39250) |
| isopentadecanoate (CHEBI:70826) is conjugate base of isopentadecanoic acid (CHEBI:39250) |
| IUPAC Name |
|---|
| 13-methyltetradecanoic acid |
| Synonyms | Source |
|---|---|
| Isopentadecylic acid | LIPID MAPS |
| 13-methylmyristic acid | LIPID MAPS |
| 13-Mtd | ChemIDplus |
| 13-Methyl-tetradecansäure | ChEBI |
| i-15:0 | ChEBI |
| iso-C15 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01020009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1773830 | Reaxys |
| CAS:2485-71-4 | ChemIDplus |
| Citations |
|---|