EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C/C(C)=C\C/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C15H24/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6,9-10,12H,1,7-8,11H2,2-5H3/b14-10-,15-12- |
| InChIKey | CXENHBSYCFFKJS-LOQWIJHWSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z,Z)-α-farnesene (CHEBI:39239) is a α-farnesene (CHEBI:39236) |
| IUPAC Name |
|---|
| (3Z,6Z)-3,7,11-trimethyldodeca-1,3,6,10-tetraene |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2204279 | Reaxys |
| CAS:28973-99-1 | ChemIDplus |