Croconazole (CHEBI:3920)

CHEBI:3920 - Croconazole

Formula	C18H15ClN2O
Net Charge	0
Average Mass	310.784
Monoisotopic Mass	310.08729
SMILES	C=C(c1ccccc1OCc1cccc(Cl)c1)n1ccnc1
InChI	InChI=1S/C18H15ClN2O/c1-14(21-10-9-20-13-21)17-7-2-3-8-18(17)22-12-15-5-4-6-16(19)11-15/h2-11,13H,1,12H2
InChIKey	WHPAGCJNPTUGGD-UHFFFAOYSA-N

Roles Classification

antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals.

antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce.

antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals.

ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol.

antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce.

ergosterol biosynthesis inhibitor Any compound that inhibits one or more steps in the pathway leading to the synthesis of ergosterol.

antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce.

antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals.

ChEBI Ontology

Outgoing Relation(s)
	Croconazole (CHEBI:3920) is a aromatic ether (CHEBI:35618)
	Croconazole (CHEBI:3920) is a conazole antifungal drug (CHEBI:87071)
	Croconazole (CHEBI:3920) is a imidazole antifungal drug (CHEBI:87069)
	Croconazole (CHEBI:3920) is a monochlorobenzenes (CHEBI:83403)

Registry Numbers	Sources
CAS:77175-51-0	KEGG COMPOUND