EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21NO4S4 |
| Net Charge | 0 |
| Average Mass | 431.626 |
| Monoisotopic Mass | 431.03534 |
| SMILES | CN(C)C(CSS(=O)(=O)c1ccccc1)CSS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H21NO4S4/c1-18(2)15(13-23-25(19,20)16-9-5-3-6-10-16)14-24-26(21,22)17-11-7-4-8-12-17/h3-12,15H,13-14H2,1-2H3 |
| InChIKey | YFXPPSKYMBTNAV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bensultap (CHEBI:39188) is a nereistoxin analogue insecticide (CHEBI:39191) |
| IUPAC Name |
|---|
| S,S'-[2-(dimethylamino)propane-1,3-diyl] dibenzenesulfonothioate |
| Synonyms | Source |
|---|---|
| Bensultap | ChemIDplus |
| nereistoxin dibenzenesulfonate | ChemIDplus |
| S,S'-(2-(dimethylamino)trimethylene)bis(benzenethiosulfonate) | ChemIDplus |
| S,S'-2-dimethylaminotrimethylene di(benzenethiosulfonate) | ChemIDplus |
| S,S'-2-dimethylaminotrimethylene di(benzenethiosulphonate) | ChemIDplus |
| thiobenzenesulfonic acid S,S'-(2-(dimethylamino)trimethylene) ester | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2228033 | Beilstein |
| CAS:17606-31-4 | ChemIDplus |
| CAS:17606-31-4 | KEGG COMPOUND |