EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N4O3 |
| Net Charge | 0 |
| Average Mass | 202.214 |
| Monoisotopic Mass | 202.10659 |
| SMILES | CNC(=N[N+](=O)[O-])NCC1CCOC1 |
| InChI | InChI=1S/C7H14N4O3/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6/h6H,2-5H2,1H3,(H2,8,9,10) |
| InChIKey | YKBZOVFACRVRJN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| Application: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dinotefuran (CHEBI:39183) has functional parent 2-nitroguanidine (CHEBI:39181) |
| dinotefuran (CHEBI:39183) has role neonicotinoid insectide (CHEBI:25540) |
| dinotefuran (CHEBI:39183) is a oxolanes (CHEBI:26912) |
| Incoming Relation(s) |
| (E)-dinotefuran (CHEBI:39184) is a dinotefuran (CHEBI:39183) |
| IUPAC Name |
|---|
| 1-methyl-2-nitro-3-(tetrahydrofuran-3-ylmethyl)guanidine |
| Synonyms | Source |
|---|---|
| 1-methyl-2-nitro-3-(tetrahydro-3-furylmethyl)guanidine | ChemIDplus |
| Dinotefuran | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1195 | PPDB |
| C18509 | KEGG COMPOUND |
| dinotefuran | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10659734 | Beilstein |
| CAS:165252-70-0 | ChemIDplus |
| CAS:165252-70-0 | KEGG COMPOUND |