EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O4 |
| Net Charge | 0 |
| Average Mass | 328.408 |
| Monoisotopic Mass | 328.16746 |
| SMILES | CC(/C=C/C=C(\C)C(=O)O)=C\C=C\C=C(C)\C=C\C=C(/C)C(=O)O |
| InChI | InChI=1S/C20H24O4/c1-15(11-7-13-17(3)19(21)22)9-5-6-10-16(2)12-8-14-18(4)20(23)24/h5-14H,1-4H3,(H,21,22)(H,23,24)/b6-5+,11-7+,12-8+,15-9+,16-10+,17-13+,18-14+ |
| InChIKey | PANKHBYNKQNAHN-MQQNZMFNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crocetin (CHEBI:3918) has role anticoronaviral agent (CHEBI:149553) |
| crocetin (CHEBI:3918) has role antineoplastic agent (CHEBI:35610) |
| crocetin (CHEBI:3918) has role antioxidant (CHEBI:22586) |
| crocetin (CHEBI:3918) has role metabolite (CHEBI:25212) |
| crocetin (CHEBI:3918) has role nutraceutical (CHEBI:50733) |
| crocetin (CHEBI:3918) is a carotenoic acid (CHEBI:35311) |
| crocetin (CHEBI:3918) is a diterpenoid (CHEBI:23849) |
| crocetin (CHEBI:3918) is a polyunsaturated dicarboxylic acid (CHEBI:134531) |
| crocetin (CHEBI:3918) is conjugate acid of crocetin(2−) (CHEBI:62767) |
| Incoming Relation(s) |
| bis(β-D-glucosyl) crocetin (CHEBI:62768) has functional parent crocetin (CHEBI:3918) |
| β-D-gentiobiosyl crocetin (CHEBI:62769) has functional parent crocetin (CHEBI:3918) |
| β-D-glucosyl crocetin (CHEBI:62765) has functional parent crocetin (CHEBI:3918) |
| crocetin(2−) (CHEBI:62767) is conjugate base of crocetin (CHEBI:3918) |
| IUPAC Names |
|---|
| (2E,4E,6E,8E,10E,12E,14E)-2,6,11,15-tetramethylhexadeca-2,4,6,8,10,12,14-heptaenedioic acid |
| 8,8'-diapocarotene-8,8'-dioic acid |
| INNs | Source |
|---|---|
| transcrocetin | WHO MedNet |
| transcrocetina | WHO MedNet |
| transcrocetine | WHO MedNet |
| Synonyms | Source |
|---|---|
| 8,8'-diapo-8,8'-carotenedioic acid | IUBMB |
| 8,8-diapocarotenedioic acid | ChEMBL |
| 8,8'-diapocarotenedioic acid | ChemIDplus |
| 8,8'-diapo-ψ,ψ-carotenedioic acid | ChemIDplus |
| Ci 75100 | ChEMBL |
| CI-75100 | ChEMBL |
| Brand Name | Source |
|---|---|
| Transcrocetin component of leaf-4l6715 ate | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| C00003768 | KNApSAcK |
| C08588 | KEGG COMPOUND |
| CPD-8662 | MetaCyc |
| Crocetin | Wikipedia |
| LMPR0104010020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1715455 | Reaxys |
| CAS:27876-94-4 | ChemIDplus |
| CAS:27876-94-4 | KEGG COMPOUND |
| Citations |
|---|