EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H9ClN4S |
| Net Charge | 0 |
| Average Mass | 252.730 |
| Monoisotopic Mass | 252.02364 |
| SMILES | N#C/N=C1\SCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H9ClN4S/c11-9-2-1-8(5-13-9)6-15-3-4-16-10(15)14-7-12/h1-2,5H,3-4,6H2/b14-10- |
| InChIKey | HOKKPVIRMVDYPB-UVTDQMKNSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-thiacloprid (CHEBI:39176) is a thiacloprid (CHEBI:39175) |
| IUPAC Name |
|---|
| {(2Z)-3-[(6-chloropyridin-3-yl)methyl]-1,3-thiazolidin-2-ylidene}cyanamide |
| Manual Xrefs | Databases |
|---|---|
| 630 | PPDB |
| C18512 | KEGG COMPOUND |
| TH4 | PDBeChem |
| thiacloprid | Alan Wood's Pesticides |
| Thiacloprid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8983861 | Beilstein |
| CAS:111988-49-9 | KEGG COMPOUND |