EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10ClN5O2 |
| Net Charge | 0 |
| Average Mass | 255.665 |
| Monoisotopic Mass | 255.05230 |
| SMILES | O=[N+]([O-])/N=C1\NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H10ClN5O2/c10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h1-2,5H,3-4,6H2,(H,11,13) |
| InChIKey | YWTYJOPNNQFBPC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| Applications: | nicotinic acetylcholine receptor agonist An agonist that selectively binds to and activates a nicotinic acetylcholine receptor. neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-imidacloprid (CHEBI:39168) is a imidacloprid (CHEBI:5870) |
| IUPAC Name |
|---|
| (2E)-1-[(6-chloropyridin-3-yl)methyl]-N-nitroimidazolidin-2-imine |
| Manual Xrefs | Databases |
|---|---|
| 397 | VSDB |
| 397 | PPDB |
| C11110 | KEGG COMPOUND |
| IM4 | PDBeChem |
| imidacloprid | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8069674 | Beilstein |
| CAS:138261-41-3 | NIST Chemistry WebBook |
| CAS:138261-41-3 | ChemIDplus |
| Citations |
|---|