EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11ClN4 |
| Net Charge | 0 |
| Average Mass | 222.679 |
| Monoisotopic Mass | 222.06722 |
| SMILES | C/C(=N/C#N)N(C)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H11ClN4/c1-8(14-7-12)15(2)6-9-3-4-10(11)13-5-9/h3-5H,6H2,1-2H3/b14-8- |
| InChIKey | WCXDHFDTOYPNIE-ZSOIEALJSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| Application: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-acetamiprid (CHEBI:39165) is a acetamiprid (CHEBI:39163) |
| IUPAC Name |
|---|
| (1Z)-N-[(6-chloropyridin-3-yl)methyl]-N'-cyano-N-methylethanimidamide |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8409860 | Beilstein |